C25H29BrIN3O3 — CID 126324071
6-bromo-2-[(2R)-butan-2-yl]-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126324071) has the molecular formula C25H29BrIN3O3 and a molecular weight of 626.33 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126324071 |
| Molecular Formula | C25H29BrIN3O3 |
| Molecular Weight | 626.33 g/mol |
| Exact Mass | 625.04 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c([C@H](C)CC)nc3ccc(Br)cc3c2=O)cc(I)c1O[C@H](C)CC |
| InChI | InChI=1S/C25H29BrIN3O3/c1-6-15(4)24-29-21-10-9-18(26)13-19(21)25(31)30(24)28-14-17-11-20(27)23(33-16(5)7-2)22(12-17)32-8-3/h9-16H,6-8H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | SRRLDOGTTRSXPW-HZPDHXFCSA-N |
| XLogP | 6.74 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.33 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|