C24H25BrIN3O5 — CID 126316323
methyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 126316323) has the molecular formula C24H25BrIN3O5 and a molecular weight of 642.29 g/mol. Its IUPAC name is methyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | methyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126316323 |
| Molecular Formula | C24H25BrIN3O5 |
| Molecular Weight | 642.29 g/mol |
| Exact Mass | 641.00 |
| IUPAC Name | methyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOc1cc(C=Nn2c([C@@H](C)CC)nc3ccc(Br)cc3c2=O)cc(I)c1OCC(=O)OC |
| InChI | InChI=1S/C24H25BrIN3O5/c1-5-14(3)23-28-19-8-7-16(25)11-17(19)24(31)29(23)27-12-15-9-18(26)22(20(10-15)33-6-2)34-13-21(30)32-4/h7-12,14H,5-6,13H2,1-4H3/t14-/m0/s1 |
| InChIKey | RNYDOALYZGFFQC-AWEZNQCLSA-N |
| XLogP | 5.11 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.29 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|