C22H20BrI2N3O2 — CID 126323228
6-bromo-2-[(2S)-butan-2-yl]-3-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126323228) has the molecular formula C22H20BrI2N3O2 and a molecular weight of 692.13 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126323228 |
| Molecular Formula | C22H20BrI2N3O2 |
| Molecular Weight | 692.13 g/mol |
| Exact Mass | 690.88 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | C=CCOc1c(I)cc(C=Nn2c([C@@H](C)CC)nc3ccc(Br)cc3c2=O)cc1I |
| InChI | InChI=1S/C22H20BrI2N3O2/c1-4-8-30-20-17(24)9-14(10-18(20)25)12-26-28-21(13(3)5-2)27-19-7-6-15(23)11-16(19)22(28)29/h4,6-7,9-13H,1,5,8H2,2-3H3/t13-/m0/s1 |
| InChIKey | NWTCDQBAVJOLMZ-ZDUSSCGKSA-N |
| XLogP | 6.33 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.13 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|