C26H20Br3I2N3O2 — CID 126319435
6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(2,4-dibromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126319435) has the molecular formula C26H20Br3I2N3O2 and a molecular weight of 899.98 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(2,4-dibromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(2,4-dibromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126319435 |
| Molecular Formula | C26H20Br3I2N3O2 |
| Molecular Weight | 899.98 g/mol |
| Exact Mass | 896.72 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(2,4-dibromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(I)c(OCc2ccc(Br)cc2Br)c(I)c1 |
| InChI | InChI=1S/C26H20Br3I2N3O2/c1-3-14(2)25-33-23-7-6-17(27)10-19(23)26(35)34(25)32-12-15-8-21(30)24(22(31)9-15)36-13-16-4-5-18(28)11-20(16)29/h4-12,14H,3,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | PEJJSAWKRBOZGD-AWEZNQCLSA-N |
| XLogP | 8.87 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.98 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|