C21H18BrI2N3O2 — CID 126306543
6-bromo-3-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one (PubChem CID 126306543) has the molecular formula C21H18BrI2N3O2 and a molecular weight of 678.11 g/mol. Its IUPAC name is 6-bromo-3-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 126306543 |
| Molecular Formula | C21H18BrI2N3O2 |
| Molecular Weight | 678.11 g/mol |
| Exact Mass | 676.87 |
| IUPAC Name | 6-bromo-3-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-2-propan-2-ylquinazolin-4-one |
| SMILES | C=CCOc1c(I)cc(C=Nn2c(C(C)C)nc3ccc(Br)cc3c2=O)cc1I |
| InChI | InChI=1S/C21H18BrI2N3O2/c1-4-7-29-19-16(23)8-13(9-17(19)24)11-25-27-20(12(2)3)26-18-6-5-14(22)10-15(18)21(27)28/h4-6,8-12H,1,7H2,2-3H3 |
| InChIKey | YRPYEDMWGDWIKY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.11 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|