C20H17BrIN3O2 — CID 126289377
6-bromo-2-ethyl-3-[(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126289377) has the molecular formula C20H17BrIN3O2 and a molecular weight of 538.18 g/mol. Its IUPAC name is 6-bromo-2-ethyl-3-[(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-ethyl-3-[(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126289377 |
| Molecular Formula | C20H17BrIN3O2 |
| Molecular Weight | 538.18 g/mol |
| Exact Mass | 536.95 |
| IUPAC Name | 6-bromo-2-ethyl-3-[(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | C=CCOc1ccc(C=Nn2c(CC)nc3ccc(Br)cc3c2=O)cc1I |
| InChI | InChI=1S/C20H17BrIN3O2/c1-3-9-27-18-8-5-13(10-16(18)22)12-23-25-19(4-2)24-17-7-6-14(21)11-15(17)20(25)26/h3,5-8,10-12H,1,4,9H2,2H3 |
| InChIKey | RJXONXLBXGFXLT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.18 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|