C24H18BrClIN3O2 — CID 126294160
6-bromo-3-[[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-ethylquinazolin-4-one (PubChem CID 126294160) has the molecular formula C24H18BrClIN3O2 and a molecular weight of 622.69 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-ethylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 126294160 |
| Molecular Formula | C24H18BrClIN3O2 |
| Molecular Weight | 622.69 g/mol |
| Exact Mass | 620.93 |
| IUPAC Name | 6-bromo-3-[[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-ethylquinazolin-4-one |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccccc2Cl)c(I)c1 |
| InChI | InChI=1S/C24H18BrClIN3O2/c1-2-23-29-21-9-8-17(25)12-18(21)24(31)30(23)28-13-15-7-10-22(20(27)11-15)32-14-16-5-3-4-6-19(16)26/h3-13H,2,14H2,1H3 |
| InChIKey | BQQGWRYYFUSDMT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.69 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|