C25H20BrCl2N3O3 — CID 126310988
6-bromo-3-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-ethylquinazolin-4-one (PubChem CID 126310988) has the molecular formula C25H20BrCl2N3O3 and a molecular weight of 561.26 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-ethylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 126310988 |
| Molecular Formula | C25H20BrCl2N3O3 |
| Molecular Weight | 561.26 g/mol |
| Exact Mass | 559.01 |
| IUPAC Name | 6-bromo-3-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-ethylquinazolin-4-one |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C25H20BrCl2N3O3/c1-3-24-30-21-8-6-17(26)11-19(21)25(32)31(24)29-13-15-4-9-22(23(10-15)33-2)34-14-16-5-7-18(27)12-20(16)28/h4-13H,3,14H2,1-2H3 |
| InChIKey | LEUJDXMAQZEKNA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.26 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|