C23H15Br2Cl2N3O2 — CID 126308669
6-bromo-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126308669) has the molecular formula C23H15Br2Cl2N3O2 and a molecular weight of 596.11 g/mol. Its IUPAC name is 6-bromo-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126308669 |
| Molecular Formula | C23H15Br2Cl2N3O2 |
| Molecular Weight | 596.11 g/mol |
| Exact Mass | 592.89 |
| IUPAC Name | 6-bromo-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H15Br2Cl2N3O2/c1-13-29-21-6-3-17(25)9-19(21)23(31)30(13)28-11-15-8-16(24)4-7-22(15)32-12-14-2-5-18(26)10-20(14)27/h2-11H,12H2,1H3 |
| InChIKey | FDOCDMZPJFOACB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.11 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|