C26H21Br2Cl2N3O2 — CID 126319084
6-bromo-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one (PubChem CID 126319084) has the molecular formula C26H21Br2Cl2N3O2 and a molecular weight of 638.19 g/mol. Its IUPAC name is 6-bromo-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126319084 |
| Molecular Formula | C26H21Br2Cl2N3O2 |
| Molecular Weight | 638.19 g/mol |
| Exact Mass | 634.94 |
| IUPAC Name | 6-bromo-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C26H21Br2Cl2N3O2/c1-3-15(2)25-32-23-8-6-18(27)11-20(23)26(34)33(25)31-13-16-4-9-24(21(28)10-16)35-14-17-5-7-19(29)12-22(17)30/h4-13,15H,3,14H2,1-2H3/t15-/m0/s1 |
| InChIKey | OKJSQWPHGWNZHY-HNNXBMFYSA-N |
| XLogP | 8.20 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.19 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|