C22H23BrClN3O2 — CID 126336635
6-bromo-2-[(2S)-butan-2-yl]-3-[(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126336635) has the molecular formula C22H23BrClN3O2 and a molecular weight of 476.80 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126336635 |
| Molecular Formula | C22H23BrClN3O2 |
| Molecular Weight | 476.80 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C22H23BrClN3O2/c1-5-14(4)21-26-19-8-7-16(23)11-17(19)22(28)27(21)25-12-15-6-9-20(18(24)10-15)29-13(2)3/h6-14H,5H2,1-4H3/t14-/m0/s1 |
| InChIKey | ATJYYJBLBHPGAL-AWEZNQCLSA-N |
| XLogP | 6.00 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.80 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|