C19H17BrClN3O — CID 126323471
6-bromo-2-[(2S)-butan-2-yl]-3-[(3-chlorophenyl)methylideneamino]quinazolin-4-one (PubChem CID 126323471) has the molecular formula C19H17BrClN3O and a molecular weight of 418.72 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[(3-chlorophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(3-chlorophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126323471 |
| Molecular Formula | C19H17BrClN3O |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(3-chlorophenyl)methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17BrClN3O/c1-3-12(2)18-23-17-8-7-14(20)10-16(17)19(25)24(18)22-11-13-5-4-6-15(21)9-13/h4-12H,3H2,1-2H3/t12-/m0/s1 |
| InChIKey | OYGDQFWWZGWQLS-LBPRGKRZSA-N |
| XLogP | 5.21 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|