C20H18BrN3O2 — CID 126310407
6-bromo-2-ethyl-3-[(4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126310407) has the molecular formula C20H18BrN3O2 and a molecular weight of 412.29 g/mol. Its IUPAC name is 6-bromo-2-ethyl-3-[(4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-ethyl-3-[(4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126310407 |
| Molecular Formula | C20H18BrN3O2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 6-bromo-2-ethyl-3-[(4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | C=CCOc1ccc(C=Nn2c(CC)nc3ccc(Br)cc3c2=O)cc1 |
| InChI | InChI=1S/C20H18BrN3O2/c1-3-11-26-16-8-5-14(6-9-16)13-22-24-19(4-2)23-18-10-7-15(21)12-17(18)20(24)25/h3,5-10,12-13H,1,4,11H2,2H3 |
| InChIKey | QORVYDBUFNCGGM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|