C21H22BrN3O4 — CID 126298495
6-bromo-3-[(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]-2-ethylquinazolin-4-one (PubChem CID 126298495) has the molecular formula C21H22BrN3O4 and a molecular weight of 460.33 g/mol. Its IUPAC name is 6-bromo-3-[(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]-2-ethylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 126298495 |
| Molecular Formula | C21H22BrN3O4 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 6-bromo-3-[(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]-2-ethylquinazolin-4-one |
| SMILES | CCOc1c(OC)cc(C=Nn2c(CC)nc3ccc(Br)cc3c2=O)cc1OC |
| InChI | InChI=1S/C21H22BrN3O4/c1-5-19-24-16-8-7-14(22)11-15(16)21(26)25(19)23-12-13-9-17(27-3)20(29-6-2)18(10-13)28-4/h7-12H,5-6H2,1-4H3 |
| InChIKey | GHCMAXDEKVINSA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|