C20H17BrIN3O5 — CID 126300750
2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid (PubChem CID 126300750) has the molecular formula C20H17BrIN3O5 and a molecular weight of 586.18 g/mol. Its IUPAC name is 2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126300750 |
| Molecular Formula | C20H17BrIN3O5 |
| Molecular Weight | 586.18 g/mol |
| Exact Mass | 584.94 |
| IUPAC Name | 2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(I)c(OCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C20H17BrIN3O5/c1-3-17-24-15-5-4-12(21)8-13(15)20(28)25(17)23-9-11-6-14(22)19(16(7-11)29-2)30-10-18(26)27/h4-9H,3,10H2,1-2H3,(H,26,27) |
| InChIKey | MTFRZPBMPAYPFZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|