C21H20BrN3O5 — CID 126285423
2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2-methoxyphenoxy]acetic acid (PubChem CID 126285423) has the molecular formula C21H20BrN3O5 and a molecular weight of 474.31 g/mol. Its IUPAC name is 2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126285423 |
| Molecular Formula | C21H20BrN3O5 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2-methoxyphenoxy]acetic acid |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C21H20BrN3O5/c1-3-4-19-24-16-7-6-14(22)10-15(16)21(28)25(19)23-11-13-5-8-17(18(9-13)29-2)30-12-20(26)27/h5-11H,3-4,12H2,1-2H3,(H,26,27) |
| InChIKey | GOTUCYCHVHFMDY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|