C23H24BrN3O3 — CID 126333981
6-bromo-2-butyl-3-[(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126333981) has the molecular formula C23H24BrN3O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126333981 |
| Molecular Formula | C23H24BrN3O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 6-bromo-2-butyl-3-[(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | C=CCOc1ccc(C=Nn2c(CCCC)nc3ccc(Br)cc3c2=O)cc1OC |
| InChI | InChI=1S/C23H24BrN3O3/c1-4-6-7-22-26-19-10-9-17(24)14-18(19)23(28)27(22)25-15-16-8-11-20(30-12-5-2)21(13-16)29-3/h5,8-11,13-15H,2,4,6-7,12H2,1,3H3 |
| InChIKey | WYKVLMYQQQFTEL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|