C23H24BrN3O6 — CID 126310795
methyl (2R)-2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]propanoate (PubChem CID 126310795) has the molecular formula C23H24BrN3O6 and a molecular weight of 518.36 g/mol. Its IUPAC name is methyl (2R)-2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]propanoate.
| Compound Name | methyl (2R)-2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 126310795 |
| Molecular Formula | C23H24BrN3O6 |
| Molecular Weight | 518.36 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | methyl (2R)-2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]propanoate |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OC)c(O[C@H](C)C(=O)OC)c(OC)c1 |
| InChI | InChI=1S/C23H24BrN3O6/c1-6-20-26-17-8-7-15(24)11-16(17)22(28)27(20)25-12-14-9-18(30-3)21(19(10-14)31-4)33-13(2)23(29)32-5/h7-13H,6H2,1-5H3/t13-/m1/s1 |
| InChIKey | KLAVIKOAIRUZFL-CYBMUJFWSA-N |
| XLogP | 3.56 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|