C22H20BrCl2N3O4 — CID 126316306
methyl (2R)-2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate (PubChem CID 126316306) has the molecular formula C22H20BrCl2N3O4 and a molecular weight of 541.23 g/mol. Its IUPAC name is methyl (2R)-2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate.
| Compound Name | methyl (2R)-2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate |
|---|---|
| PubChem CID | 126316306 |
| Molecular Formula | C22H20BrCl2N3O4 |
| Molecular Weight | 541.23 g/mol |
| Exact Mass | 539.00 |
| IUPAC Name | methyl (2R)-2-[4-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(O[C@H](C)C(=O)OC)c(Cl)c1 |
| InChI | InChI=1S/C22H20BrCl2N3O4/c1-4-5-19-27-18-7-6-14(23)10-15(18)21(29)28(19)26-11-13-8-16(24)20(17(25)9-13)32-12(2)22(30)31-3/h6-12H,4-5H2,1-3H3/t12-/m1/s1 |
| InChIKey | REHMPNLRQKMILS-GFCCVEGCSA-N |
| XLogP | 5.24 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.23 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|