C24H24BrCl2N3O4 — CID 126315309
ethyl (2R)-2-[4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate (PubChem CID 126315309) has the molecular formula C24H24BrCl2N3O4 and a molecular weight of 569.28 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate |
|---|---|
| PubChem CID | 126315309 |
| Molecular Formula | C24H24BrCl2N3O4 |
| Molecular Weight | 569.28 g/mol |
| Exact Mass | 567.03 |
| IUPAC Name | ethyl (2R)-2-[4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(O[C@H](C)C(=O)OCC)c(Cl)c1 |
| InChI | InChI=1S/C24H24BrCl2N3O4/c1-4-6-7-21-29-20-9-8-16(25)12-17(20)23(31)30(21)28-13-15-10-18(26)22(19(27)11-15)34-14(3)24(32)33-5-2/h8-14H,4-7H2,1-3H3/t14-/m1/s1 |
| InChIKey | CGTQCYWOAHMARR-CQSZACIVSA-N |
| XLogP | 6.02 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.28 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|