C20H16BrCl2N3O4 — CID 126292009
methyl (2R)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate (PubChem CID 126292009) has the molecular formula C20H16BrCl2N3O4 and a molecular weight of 513.18 g/mol. Its IUPAC name is methyl (2R)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate.
| Compound Name | methyl (2R)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate |
|---|---|
| PubChem CID | 126292009 |
| Molecular Formula | C20H16BrCl2N3O4 |
| Molecular Weight | 513.18 g/mol |
| Exact Mass | 510.97 |
| IUPAC Name | methyl (2R)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1c(Cl)cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc1Cl |
| InChI | InChI=1S/C20H16BrCl2N3O4/c1-10(20(28)29-3)30-18-15(22)6-12(7-16(18)23)9-24-26-11(2)25-17-5-4-13(21)8-14(17)19(26)27/h4-10H,1-3H3/t10-/m1/s1 |
| InChIKey | OYHUGOLOJYBNRQ-SNVBAGLBSA-N |
| XLogP | 4.60 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.18 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|