C19H14BrCl2N3O4 — CID 126297475
(2S)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoic acid (PubChem CID 126297475) has the molecular formula C19H14BrCl2N3O4 and a molecular weight of 499.15 g/mol. Its IUPAC name is (2S)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoic acid |
|---|---|
| PubChem CID | 126297475 |
| Molecular Formula | C19H14BrCl2N3O4 |
| Molecular Weight | 499.15 g/mol |
| Exact Mass | 496.95 |
| IUPAC Name | (2S)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]propanoic acid |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(O[C@@H](C)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C19H14BrCl2N3O4/c1-9(19(27)28)29-17-14(21)5-11(6-15(17)22)8-23-25-10(2)24-16-4-3-12(20)7-13(16)18(25)26/h3-9H,1-2H3,(H,27,28)/t9-/m0/s1 |
| InChIKey | AUFVBTRDJAAOCV-VIFPVBQESA-N |
| XLogP | 4.51 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.15 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|