C23H23BrClN3O5 — CID 126300604
ethyl (2S)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]propanoate (PubChem CID 126300604) has the molecular formula C23H23BrClN3O5 and a molecular weight of 536.81 g/mol. Its IUPAC name is ethyl (2S)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]propanoate.
| Compound Name | ethyl (2S)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 126300604 |
| Molecular Formula | C23H23BrClN3O5 |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | ethyl (2S)-2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chloro-6-ethoxyphenoxy]propanoate |
| SMILES | CCOC(=O)[C@H](C)Oc1c(Cl)cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc1OCC |
| InChI | InChI=1S/C23H23BrClN3O5/c1-5-31-20-10-15(9-18(25)21(20)33-13(3)23(30)32-6-2)12-26-28-14(4)27-19-8-7-16(24)11-17(19)22(28)29/h7-13H,5-6H2,1-4H3/t13-/m0/s1 |
| InChIKey | OQXKDLPGTXQSBS-ZDUSSCGKSA-N |
| XLogP | 4.73 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|