C19H18BrN3O2 — CID 126287570
6-bromo-3-[(3-ethoxyphenyl)methylideneamino]-2-ethylquinazolin-4-one (PubChem CID 126287570) has the molecular formula C19H18BrN3O2 and a molecular weight of 400.28 g/mol. Its IUPAC name is 6-bromo-3-[(3-ethoxyphenyl)methylideneamino]-2-ethylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(3-ethoxyphenyl)methylideneamino]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 126287570 |
| Molecular Formula | C19H18BrN3O2 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 6-bromo-3-[(3-ethoxyphenyl)methylideneamino]-2-ethylquinazolin-4-one |
| SMILES | CCOc1cccc(C=Nn2c(CC)nc3ccc(Br)cc3c2=O)c1 |
| InChI | InChI=1S/C19H18BrN3O2/c1-3-18-22-17-9-8-14(20)11-16(17)19(24)23(18)21-12-13-6-5-7-15(10-13)25-4-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | DETULMJPQBJYAR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|