C21H20BrN3O4 — CID 126332392
2-[4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetic acid (PubChem CID 126332392) has the molecular formula C21H20BrN3O4 and a molecular weight of 458.31 g/mol. Its IUPAC name is 2-[4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126332392 |
| Molecular Formula | C21H20BrN3O4 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 2-[4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]phenoxy]acetic acid |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C21H20BrN3O4/c1-2-3-4-19-24-18-10-7-15(22)11-17(18)21(28)25(19)23-12-14-5-8-16(9-6-14)29-13-20(26)27/h5-12H,2-4,13H2,1H3,(H,26,27) |
| InChIKey | IWQCLCWGLYQIMD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|