C21H19BrN4O6 — CID 126328841
2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetic acid (PubChem CID 126328841) has the molecular formula C21H19BrN4O6 and a molecular weight of 503.31 g/mol. Its IUPAC name is 2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetic acid.
| Compound Name | 2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetic acid |
|---|---|
| PubChem CID | 126328841 |
| Molecular Formula | C21H19BrN4O6 |
| Molecular Weight | 503.31 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetic acid |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc([N+](=O)[O-])ccc1OCC(=O)O |
| InChI | InChI=1S/C21H19BrN4O6/c1-2-3-4-19-24-17-7-5-14(22)10-16(17)21(29)25(19)23-11-13-9-15(26(30)31)6-8-18(13)32-12-20(27)28/h5-11H,2-4,12H2,1H3,(H,27,28) |
| InChIKey | LKAADQLYDRHRKW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|