C30H25BrN4O4 — CID 126308755
6-bromo-2-butyl-3-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one (PubChem CID 126308755) has the molecular formula C30H25BrN4O4 and a molecular weight of 585.46 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126308755 |
| Molecular Formula | C30H25BrN4O4 |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 6-bromo-2-butyl-3-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1c(OCc2cccc([N+](=O)[O-])c2)ccc2ccccc12 |
| InChI | InChI=1S/C30H25BrN4O4/c1-2-3-11-29-33-27-14-13-22(31)17-25(27)30(36)34(29)32-18-26-24-10-5-4-8-21(24)12-15-28(26)39-19-20-7-6-9-23(16-20)35(37)38/h4-10,12-18H,2-3,11,19H2,1H3 |
| InChIKey | JPGBTPICPRBASP-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|