C31H28BrN3O2 — CID 126336956
6-bromo-2-butyl-3-[[2-[(3-methylphenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one (PubChem CID 126336956) has the molecular formula C31H28BrN3O2 and a molecular weight of 554.49 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[[2-[(3-methylphenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[[2-[(3-methylphenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126336956 |
| Molecular Formula | C31H28BrN3O2 |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 6-bromo-2-butyl-3-[[2-[(3-methylphenyl)methoxy]naphthalen-1-yl]methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1c(OCc2cccc(C)c2)ccc2ccccc12 |
| InChI | InChI=1S/C31H28BrN3O2/c1-3-4-12-30-34-28-15-14-24(32)18-26(28)31(36)35(30)33-19-27-25-11-6-5-10-23(25)13-16-29(27)37-20-22-9-7-8-21(2)17-22/h5-11,13-19H,3-4,12,20H2,1-2H3 |
| InChIKey | BNEYTZFDCUCJPH-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|