C28H22BrN3O2 — CID 126292473
6-bromo-2-ethyl-3-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]quinazolin-4-one (PubChem CID 126292473) has the molecular formula C28H22BrN3O2 and a molecular weight of 512.41 g/mol. Its IUPAC name is 6-bromo-2-ethyl-3-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-ethyl-3-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126292473 |
| Molecular Formula | C28H22BrN3O2 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 6-bromo-2-ethyl-3-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]quinazolin-4-one |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1c(OCc2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C28H22BrN3O2/c1-2-27-31-25-14-13-21(29)16-23(25)28(33)32(27)30-17-24-22-11-7-6-10-20(22)12-15-26(24)34-18-19-8-4-3-5-9-19/h3-17H,2,18H2,1H3 |
| InChIKey | YIQFLKRZMLEYFV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|