C29H23BrFN3O2 — CID 126331068
6-bromo-3-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126331068) has the molecular formula C29H23BrFN3O2 and a molecular weight of 544.42 g/mol. Its IUPAC name is 6-bromo-3-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126331068 |
| Molecular Formula | C29H23BrFN3O2 |
| Molecular Weight | 544.42 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 6-bromo-3-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1c(OCc2ccc(F)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C29H23BrFN3O2/c1-2-5-28-33-26-14-11-21(30)16-24(26)29(35)34(28)32-17-25-23-7-4-3-6-20(23)10-15-27(25)36-18-19-8-12-22(31)13-9-19/h3-4,6-17H,2,5,18H2,1H3 |
| InChIKey | WLRDFVBCEHNACB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.42 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|