C24H19BrN6O6 — CID 126325286
6-bromo-2-butyl-3-[[5-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126325286) has the molecular formula C24H19BrN6O6 and a molecular weight of 567.36 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[[5-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[[5-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126325286 |
| Molecular Formula | C24H19BrN6O6 |
| Molecular Weight | 567.36 g/mol |
| Exact Mass | 566.05 |
| IUPAC Name | 6-bromo-2-butyl-3-[[5-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc([N+](=O)[O-])ccc1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C24H19BrN6O6/c1-2-3-4-22-28-20-8-5-16(25)12-19(20)24(32)29(22)27-13-15-11-17(30(33)34)6-9-21(15)37-23-10-7-18(14-26-23)31(35)36/h5-14H,2-4H2,1H3 |
| InChIKey | ATEITPMVNFEGLV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 155.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|