C25H20Br3N5O5 — CID 126321647
6-bromo-2-butyl-3-[[2,3-dibromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126321647) has the molecular formula C25H20Br3N5O5 and a molecular weight of 710.18 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[[2,3-dibromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[[2,3-dibromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126321647 |
| Molecular Formula | C25H20Br3N5O5 |
| Molecular Weight | 710.18 g/mol |
| Exact Mass | 706.90 |
| IUPAC Name | 6-bromo-2-butyl-3-[[2,3-dibromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OC)c(Oc2ccc([N+](=O)[O-])cn2)c(Br)c1Br |
| InChI | InChI=1S/C25H20Br3N5O5/c1-3-4-5-20-31-18-8-6-15(26)11-17(18)25(34)32(20)30-12-14-10-19(37-2)24(23(28)22(14)27)38-21-9-7-16(13-29-21)33(35)36/h6-13H,3-5H2,1-2H3 |
| InChIKey | VTVOMMBFYWHULU-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 121.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.18 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|