C24H17Br3N4O4 — CID 126300270
6-bromo-3-[[2-[(2,4-dibromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-ethylquinazolin-4-one (PubChem CID 126300270) has the molecular formula C24H17Br3N4O4 and a molecular weight of 665.14 g/mol. Its IUPAC name is 6-bromo-3-[[2-[(2,4-dibromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-ethylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[2-[(2,4-dibromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 126300270 |
| Molecular Formula | C24H17Br3N4O4 |
| Molecular Weight | 665.14 g/mol |
| Exact Mass | 661.88 |
| IUPAC Name | 6-bromo-3-[[2-[(2,4-dibromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-ethylquinazolin-4-one |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc([N+](=O)[O-])ccc1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C24H17Br3N4O4/c1-2-23-29-21-7-5-16(25)10-19(21)24(32)30(23)28-12-15-9-18(31(33)34)6-8-22(15)35-13-14-3-4-17(26)11-20(14)27/h3-12H,2,13H2,1H3 |
| InChIKey | LESSQDQSEONSAF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.14 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|