C21H13Br2N5O4 — CID 126304933
6-bromo-3-[[5-bromo-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126304933) has the molecular formula C21H13Br2N5O4 and a molecular weight of 559.17 g/mol. Its IUPAC name is 6-bromo-3-[[5-bromo-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-bromo-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126304933 |
| Molecular Formula | C21H13Br2N5O4 |
| Molecular Weight | 559.17 g/mol |
| Exact Mass | 556.93 |
| IUPAC Name | 6-bromo-3-[[5-bromo-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)ccc1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C21H13Br2N5O4/c1-12-26-18-5-2-15(23)9-17(18)21(29)27(12)25-10-13-8-14(22)3-6-19(13)32-20-7-4-16(11-24-20)28(30)31/h2-11H,1H3 |
| InChIKey | XQOPPKMHCRPMLZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 112.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.17 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|