C25H21Br2N5O5 — CID 126290571
6-bromo-3-[[3-bromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-tert-butylquinazolin-4-one (PubChem CID 126290571) has the molecular formula C25H21Br2N5O5 and a molecular weight of 631.28 g/mol. Its IUPAC name is 6-bromo-3-[[3-bromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-tert-butylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-bromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126290571 |
| Molecular Formula | C25H21Br2N5O5 |
| Molecular Weight | 631.28 g/mol |
| Exact Mass | 628.99 |
| IUPAC Name | 6-bromo-3-[[3-bromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc(Br)c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C25H21Br2N5O5/c1-25(2,3)24-30-19-7-5-15(26)11-17(19)23(33)31(24)29-12-14-9-18(27)22(20(10-14)36-4)37-21-8-6-16(13-28-21)32(34)35/h5-13H,1-4H3 |
| InChIKey | SWHSDJODIFEBCQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 121.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.28 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|