C21H14BrN5O6 — CID 126347618
3-[[3-bromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 126347618) has the molecular formula C21H14BrN5O6 and a molecular weight of 512.28 g/mol. Its IUPAC name is 3-[[3-bromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[3-bromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 126347618 |
| Molecular Formula | C21H14BrN5O6 |
| Molecular Weight | 512.28 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | 3-[[3-bromo-5-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | COc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(Br)c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C21H14BrN5O6/c1-32-17-9-12(8-15(22)19(17)33-18-7-6-13(11-23-18)27(30)31)10-24-26-20(28)14-4-2-3-5-16(14)25-21(26)29/h2-11H,1H3,(H,25,29) |
| InChIKey | FDKFOZRVUZMWLC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 141.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|