C21H17Br2N5O4 — CID 126286689
2-[2-bromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetonitrile (PubChem CID 126286689) has the molecular formula C21H17Br2N5O4 and a molecular weight of 563.21 g/mol. Its IUPAC name is 2-[2-bromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetonitrile |
|---|---|
| PubChem CID | 126286689 |
| Molecular Formula | C21H17Br2N5O4 |
| Molecular Weight | 563.21 g/mol |
| Exact Mass | 560.96 |
| IUPAC Name | 2-[2-bromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetonitrile |
| SMILES | CC(C)(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)c(OCC#N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17Br2N5O4/c1-21(2,3)20-26-16-5-4-13(22)10-14(16)19(29)27(20)25-11-12-8-15(23)18(32-7-6-24)17(9-12)28(30)31/h4-5,8-11H,7H2,1-3H3 |
| InChIKey | LJULBZBQHDXWSS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 123.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.21 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|