C23H22Br2N4O3 — CID 126291753
2-[2-bromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]acetonitrile (PubChem CID 126291753) has the molecular formula C23H22Br2N4O3 and a molecular weight of 562.26 g/mol. Its IUPAC name is 2-[2-bromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 126291753 |
| Molecular Formula | C23H22Br2N4O3 |
| Molecular Weight | 562.26 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | 2-[2-bromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]acetonitrile |
| SMILES | CCOc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc(Br)c1OCC#N |
| InChI | InChI=1S/C23H22Br2N4O3/c1-5-31-19-11-14(10-17(25)20(19)32-9-8-26)13-27-29-21(30)16-12-15(24)6-7-18(16)28-22(29)23(2,3)4/h6-7,10-13H,5,9H2,1-4H3 |
| InChIKey | WFUIOSQJSMXBDT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 89.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.26 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|