C23H25BrN4O5 — CID 126305730
6-bromo-2-tert-butyl-3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one (PubChem CID 126305730) has the molecular formula C23H25BrN4O5 and a molecular weight of 517.38 g/mol. Its IUPAC name is 6-bromo-2-tert-butyl-3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-tert-butyl-3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126305730 |
| Molecular Formula | C23H25BrN4O5 |
| Molecular Weight | 517.38 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 6-bromo-2-tert-butyl-3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C23H25BrN4O5/c1-6-32-19-11-14(10-18(28(30)31)20(19)33-7-2)13-25-27-21(29)16-12-15(24)8-9-17(16)26-22(27)23(3,4)5/h8-13H,6-7H2,1-5H3 |
| InChIKey | QSJRIHGIOXVXQM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|