C16H10BrClN4O3 — CID 126308435
6-bromo-3-[(2-chloro-4-nitrophenyl)methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126308435) has the molecular formula C16H10BrClN4O3 and a molecular weight of 421.64 g/mol. Its IUPAC name is 6-bromo-3-[(2-chloro-4-nitrophenyl)methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(2-chloro-4-nitrophenyl)methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126308435 |
| Molecular Formula | C16H10BrClN4O3 |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | 6-bromo-3-[(2-chloro-4-nitrophenyl)methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H10BrClN4O3/c1-9-20-15-5-3-11(17)6-13(15)16(23)21(9)19-8-10-2-4-12(22(24)25)7-14(10)18/h2-8H,1H3 |
| InChIKey | CQHSRAKIENMYMH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|