C25H18BrN5O3 — CID 126303684
6-bromo-2-methyl-3-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126303684) has the molecular formula C25H18BrN5O3 and a molecular weight of 516.36 g/mol. Its IUPAC name is 6-bromo-2-methyl-3-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-methyl-3-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126303684 |
| Molecular Formula | C25H18BrN5O3 |
| Molecular Weight | 516.36 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | 6-bromo-2-methyl-3-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1cn(Cc2cccc([N+](=O)[O-])c2)c2ccccc12 |
| InChI | InChI=1S/C25H18BrN5O3/c1-16-28-23-10-9-19(26)12-22(23)25(32)30(16)27-13-18-15-29(24-8-3-2-7-21(18)24)14-17-5-4-6-20(11-17)31(33)34/h2-13,15H,14H2,1H3 |
| InChIKey | UAAOMPVDVBGCTA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 95.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|