C26H21BrN4O — CID 126296546
6-bromo-2-methyl-3-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126296546) has the molecular formula C26H21BrN4O and a molecular weight of 485.39 g/mol. Its IUPAC name is 6-bromo-2-methyl-3-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-methyl-3-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126296546 |
| Molecular Formula | C26H21BrN4O |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 6-bromo-2-methyl-3-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cccc(Cn2cc(C=Nn3c(C)nc4ccc(Br)cc4c3=O)c3ccccc32)c1 |
| InChI | InChI=1S/C26H21BrN4O/c1-17-6-5-7-19(12-17)15-30-16-20(22-8-3-4-9-25(22)30)14-28-31-18(2)29-24-11-10-21(27)13-23(24)26(31)32/h3-14,16H,15H2,1-2H3 |
| InChIKey | SLJNWZJZVRFEMN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|