C32H27BrN4O — CID 126318947
6-bromo-2-[(2S)-butan-2-yl]-3-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126318947) has the molecular formula C32H27BrN4O and a molecular weight of 563.50 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126318947 |
| Molecular Formula | C32H27BrN4O |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cn(Cc2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C32H27BrN4O/c1-3-21(2)31-35-29-16-15-25(33)17-28(29)32(38)37(31)34-18-24-20-36(30-14-7-6-13-27(24)30)19-23-11-8-10-22-9-4-5-12-26(22)23/h4-18,20-21H,3,19H2,1-2H3/t21-/m0/s1 |
| InChIKey | MOAIJZMHGZNXSB-NRFANRHFSA-N |
| XLogP | 7.71 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|