C28H24BrClN4O — CID 126323944
6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126323944) has the molecular formula C28H24BrClN4O and a molecular weight of 547.88 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126323944 |
| Molecular Formula | C28H24BrClN4O |
| Molecular Weight | 547.88 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cn(Cc2ccccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C28H24BrClN4O/c1-3-18(2)27-32-25-13-12-21(29)14-23(25)28(35)34(27)31-15-20-17-33(26-11-7-5-9-22(20)26)16-19-8-4-6-10-24(19)30/h4-15,17-18H,3,16H2,1-2H3/t18-/m1/s1 |
| InChIKey | VUSSPVMPRHFYIG-GOSISDBHSA-N |
| XLogP | 7.21 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.88 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|