C25H27BrN4O — CID 126320805
6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126320805) has the molecular formula C25H27BrN4O and a molecular weight of 479.42 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126320805 |
| Molecular Formula | C25H27BrN4O |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cn([C@@H](C)CC)c2ccccc12 |
| InChI | InChI=1S/C25H27BrN4O/c1-5-16(3)24-28-22-12-11-19(26)13-21(22)25(31)30(24)27-14-18-15-29(17(4)6-2)23-10-8-7-9-20(18)23/h7-17H,5-6H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | GQQRYZUUTUJFHE-SJORKVTESA-N |
| XLogP | 6.48 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|