C30H25BrClN3O2 — CID 126327824
6-bromo-2-[(2S)-butan-2-yl]-3-[[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126327824) has the molecular formula C30H25BrClN3O2 and a molecular weight of 574.91 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126327824 |
| Molecular Formula | C30H25BrClN3O2 |
| Molecular Weight | 574.91 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H25BrClN3O2/c1-3-19(2)29-34-27-13-11-23(31)16-26(27)30(36)35(29)33-17-22-15-24(32)12-14-28(22)37-18-21-9-6-8-20-7-4-5-10-25(20)21/h4-17,19H,3,18H2,1-2H3/t19-/m0/s1 |
| InChIKey | UPWIJSRYSUXNSK-IBGZPJMESA-N |
| XLogP | 7.94 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.91 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|