C32H20BrFN4O2 — CID 126310571
2-(5-bromo-1-benzofuran-2-yl)-3-[[1-[(3-fluorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126310571) has the molecular formula C32H20BrFN4O2 and a molecular weight of 591.44 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[1-[(3-fluorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[1-[(3-fluorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126310571 |
| Molecular Formula | C32H20BrFN4O2 |
| Molecular Weight | 591.44 g/mol |
| Exact Mass | 590.08 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[1-[(3-fluorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Br)ccc3o2)n1N=Cc1cn(Cc2cccc(F)c2)c2ccccc12 |
| InChI | InChI=1S/C32H20BrFN4O2/c33-23-12-13-29-21(15-23)16-30(40-29)31-36-27-10-3-1-9-26(27)32(39)38(31)35-17-22-19-37(28-11-4-2-8-25(22)28)18-20-6-5-7-24(34)14-20/h1-17,19H,18H2 |
| InChIKey | KCEQPTYNDQBBCI-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 65.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.44 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|