C30H23BrN4O2 — CID 126307982
3-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-(5-bromo-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126307982) has the molecular formula C30H23BrN4O2 and a molecular weight of 551.44 g/mol. Its IUPAC name is 3-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-(5-bromo-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-(5-bromo-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126307982 |
| Molecular Formula | C30H23BrN4O2 |
| Molecular Weight | 551.44 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 3-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-(5-bromo-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C30H23BrN4O2/c1-19-14-23(20(2)34(19)18-21-8-4-3-5-9-21)17-32-35-29(33-26-11-7-6-10-25(26)30(35)36)28-16-22-15-24(31)12-13-27(22)37-28/h3-17H,18H2,1-2H3 |
| InChIKey | BHYSMABOBSYUIB-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 65.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.44 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|