C32H21N5O4 — CID 126303432
2-(1-benzofuran-2-yl)-3-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126303432) has the molecular formula C32H21N5O4 and a molecular weight of 539.55 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126303432 |
| Molecular Formula | C32H21N5O4 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3ccccc3o2)n1N=Cc1cn(Cc2ccc([N+](=O)[O-])cc2)c2ccccc12 |
| InChI | InChI=1S/C32H21N5O4/c38-32-26-9-2-4-10-27(26)34-31(30-17-22-7-1-6-12-29(22)41-30)36(32)33-18-23-20-35(28-11-5-3-8-25(23)28)19-21-13-15-24(16-14-21)37(39)40/h1-18,20H,19H2 |
| InChIKey | TWJKIGWOZNVKPZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 108.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|