C28H19ClN4O2 — CID 126309273
2-(5-chloro-1-benzofuran-2-yl)-3-[(1-prop-2-enylindol-3-yl)methylideneamino]quinazolin-4-one (PubChem CID 126309273) has the molecular formula C28H19ClN4O2 and a molecular weight of 478.94 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[(1-prop-2-enylindol-3-yl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[(1-prop-2-enylindol-3-yl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126309273 |
| Molecular Formula | C28H19ClN4O2 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[(1-prop-2-enylindol-3-yl)methylideneamino]quinazolin-4-one |
| SMILES | C=CCn1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C28H19ClN4O2/c1-2-13-32-17-19(21-7-4-6-10-24(21)32)16-30-33-27(31-23-9-5-3-8-22(23)28(33)34)26-15-18-14-20(29)11-12-25(18)35-26/h2-12,14-17H,1,13H2 |
| InChIKey | GDYIWAZADSGTBX-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 65.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|